|
CAS#: 26759-52-4 Product: Methyl 3-Hydroxy-5-Nitro-2,3-Dihydro-1-Benzothiophene-3-Carboxylate No suppilers available for the product. |
| Name | Methyl 3-Hydroxy-5-Nitro-2,3-Dihydro-1-Benzothiophene-3-Carboxylate |
|---|---|
| Synonyms | methyl 3-hydroxy-5-nitrobenzo[b]thiophene-3-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9NO5S |
| Molecular Weight | 255.25 |
| CAS Registry Number | 26759-52-4 |
| EINECS | 247-972-4 |
| SMILES | [O-][N+](=O)c1cc2c(cc1)SCC2(O)C(=O)OC |
| InChI | 1S/C10H9NO5S/c1-16-9(12)10(13)5-17-8-3-2-6(11(14)15)4-7(8)10/h2-4,13H,5H2,1H3 |
| InChIKey | MZCCUBUNRNTJCU-UHFFFAOYSA-N |
| Density | 1.567g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.876°C at 760 mmHg (Cal.) |
| Flash point | 201.686°C (Cal.) |
| Refractive index | 1.671 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 3-Hydroxy-5-Nitro-2,3-Dihydro-1-Benzothiophene-3-Carboxylate |