|
CAS#: 26766-27-8 Product: Triarimol No suppilers available for the product. |
| Name | Triarimol |
|---|---|
| Synonyms | (2,4-Dichlorophenyl)-Phenyl-Pyrimidin-5-Yl-Methanol; (2,4-Dichlorophenyl)-Phenyl-(5-Pyrimidinyl)Methanol; 5-23-12-00538 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C17H12Cl2N2O |
| Molecular Weight | 331.20 |
| CAS Registry Number | 26766-27-8 |
| SMILES | C3=C(C(O)(C1=CN=CN=C1)C2=CC=CC=C2)C(=CC(=C3)Cl)Cl |
| InChI | 1S/C17H12Cl2N2O/c18-14-6-7-15(16(19)8-14)17(22,12-4-2-1-3-5-12)13-9-20-11-21-10-13/h1-11,22H |
| InChIKey | MYUPFXPCYUISAG-UHFFFAOYSA-N |
| Density | 1.376g/cm3 (Cal.) |
|---|---|
| Boiling point | 501.598°C at 760 mmHg (Cal.) |
| Flash point | 257.157°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Triarimol |