|
CAS#: 26774-80-1 Product: 1-(1-Naphthylsulfonyl)-5-Oxo-L-Proline No suppilers available for the product. |
| Name | 1-(1-Naphthylsulfonyl)-5-Oxo-L-Proline |
|---|---|
| Synonyms | 1-(naphthylsulphonyl)-5-oxo-L-proline |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13NO5S |
| Molecular Weight | 319.33 |
| CAS Registry Number | 26774-80-1 |
| EINECS | 247-998-6 |
| SMILES | O=C1CC[C@@H](C(O)=O)N1S(=O)(=O)c3cccc2ccccc23 |
| InChI | 1S/C15H13NO5S/c17-14-9-8-12(15(18)19)16(14)22(20,21)13-7-3-5-10-4-1-2-6-11(10)13/h1-7,12H,8-9H2,(H,18,19)/t12-/m0/s1 |
| InChIKey | CJHLTELXCRYESZ-LBPRGKRZSA-N |
| Density | 1.521g/cm3 (Cal.) |
|---|---|
| Boiling point | 581.098°C at 760 mmHg (Cal.) |
| Flash point | 305.237°C (Cal.) |
| Refractive index | 1.685 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1-Naphthylsulfonyl)-5-Oxo-L-Proline |