| Ryan Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | Benzo[f][1]Benzothiole |
|---|---|
| Synonyms | Benzo[F]Benzothiophene; Sr-01000634836-1 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8S |
| Molecular Weight | 184.26 |
| CAS Registry Number | 268-77-9 |
| EINECS | 205-977-9 |
| SMILES | C1=CC2=C(C=C1)C=C3C(=C2)C=CS3 |
| InChI | 1S/C12H8S/c1-2-4-10-8-12-11(5-6-13-12)7-9(10)3-1/h1-8H |
| InChIKey | CYKIHIBNSFRKQP-UHFFFAOYSA-N |
| Density | 1.252g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.16°C at 760 mmHg (Cal.) |
| Flash point | 118.434°C (Cal.) |
| (1) | Masashi Mamada, Jun-ichi Nishida, Daisuke Kumaki, Shizuo Tokito and Yoshiro Yamashita. High performance organic field-effect transistors based on [2,2′]bi[naphtho[2,3-b]thiophenyl] with a simple structure, J. Mater. Chem., 2008, 18, 3442. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Benzo[f][1]Benzothiole |