|
CAS#: 26818-10-0 Product: 3-Oxo-2-Butanyl 3,4,5-Trihydroxybenzoate No suppilers available for the product. |
| Name | 3-Oxo-2-Butanyl 3,4,5-Trihydroxybenzoate |
|---|---|
| Synonyms | 1-Methyl-2-oxopropyl 3,4,5-trihydroxybenzoate # |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12O6 |
| Molecular Weight | 240.21 |
| CAS Registry Number | 26818-10-0 |
| SMILES | O=C(C)C(OC(=O)c1cc(O)c(O)c(O)c1)C |
| InChI | 1S/C11H12O6/c1-5(12)6(2)17-11(16)7-3-8(13)10(15)9(14)4-7/h3-4,6,13-15H,1-2H3 |
| InChIKey | QGHKLYWATOLWIR-UHFFFAOYSA-N |
| Density | 1.416g/cm3 (Cal.) |
|---|---|
| Boiling point | 506.72°C at 760 mmHg (Cal.) |
| Flash point | 201.454°C (Cal.) |
| Refractive index | 1.594 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Oxo-2-Butanyl 3,4,5-Trihydroxybenzoate |