Online Database of Chemicals from Around the World
|
CAS#: 26905-18-0 Product: 1-(Adamantan-1-Yl)-3-(1-Methylcyclopentyl)-2-Aziridinone No suppilers available for the product. |
| Name | 1-(Adamantan-1-Yl)-3-(1-Methylcyclopentyl)-2-Aziridinone |
|---|---|
| Synonyms | 1-(1-Adamantyl)-3-(1-methylcyclopentyl)-2-aziridinone # |
| Molecular Structure |  |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.41 |
| CAS Registry Number | 26905-18-0 |
| SMILES | O=C4N(C13CC2CC(C1)CC(C2)C3)C4C5(C)CCCC5 |
| InChI | 1S/C18H27NO/c1-17(4-2-3-5-17)15-16(20)19(15)18-9-12-6-13(10-18)8-14(7-12)11-18/h12-15H,2-11H2,1H3 |
| InChIKey | VANCODNETSKJPC-UHFFFAOYSA-N |
| Density | 1.192g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.383°C at 760 mmHg (Cal.) |
| Flash point | 156.283°C (Cal.) |
| Refractive index | 1.603 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Adamantan-1-Yl)-3-(1-Methylcyclopentyl)-2-Aziridinone |