|
CAS#: 26909-37-5 Product: 10-Decarbamoylmitomycin C No suppilers available for the product. |
| Name | 10-Decarbamoylmitomycin C |
|---|---|
| Synonyms | Decarbamylmitomycin C; 10-Decarbamoyl Mitomycin C; 10-Decarbamoylmitomycin C |
| Molecular Structure | ![]() |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 |
| CAS Registry Number | 26909-37-5 |
| SMILES | [C@@]23(OC)N(C1=C(C(C(=C(C1=O)C)N)=O)[C@H]2CO)C[C@H]4N[C@@H]34 |
| InChI | 1S/C14H17N3O4/c1-5-9(15)12(20)8-6(4-18)14(21-2)13-7(16-13)3-17(14)10(8)11(5)19/h6-7,13,16,18H,3-4,15H2,1-2H3/t6-,7-,13-,14+/m1/s1 |
| InChIKey | OUADMZZEIRSDSG-CHFCKMNRSA-N |
| Density | 1.547g/cm3 (Cal.) |
|---|---|
| Boiling point | 501.603°C at 760 mmHg (Cal.) |
| Flash point | 257.161°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10-Decarbamoylmitomycin C |