|
CAS#: 26964-26-1 Product: 8-Methoxy-2-Phenylchromone No suppilers available for the product. |
| Name | 8-Methoxy-2-Phenylchromone |
|---|---|
| Synonyms | 8-Methoxy-2-Phenyl-Chromen-4-One; 8-Methoxy-2-Phenyl-4-Chromenone; 8-Methoxy-2-Phenyl-Chromone |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12O3 |
| Molecular Weight | 252.27 |
| CAS Registry Number | 26964-26-1 |
| SMILES | C2=CC=C1C(C=C(OC1=C2OC)C3=CC=CC=C3)=O |
| InChI | 1S/C16H12O3/c1-18-14-9-5-8-12-13(17)10-15(19-16(12)14)11-6-3-2-4-7-11/h2-10H,1H3 |
| InChIKey | FOXRKQWVTGRONY-UHFFFAOYSA-N |
| Density | 1.241g/cm3 (Cal.) |
|---|---|
| Boiling point | 422.544°C at 760 mmHg (Cal.) |
| Flash point | 201.112°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Methoxy-2-Phenylchromone |