|
CAS#: 26980-43-8 Product: 1,1,1,2-Tetrachloro-2,2-Dimethyldisilane No suppilers available for the product. |
| Name | 1,1,1,2-Tetrachloro-2,2-Dimethyldisilane |
|---|---|
| Synonyms | tetrachlorodimethyldisilane |
| Molecular Structure | ![]() |
| Molecular Formula | C2H6Cl4Si2 |
| Molecular Weight | 228.05 |
| CAS Registry Number | 26980-43-8 |
| EINECS | 248-152-9 |
| SMILES | C[Si](C)(Cl)[Si](Cl)(Cl)Cl |
| InChI | 1S/C2H6Cl4Si2/c1-7(2,3)8(4,5)6/h1-2H3 |
| InChIKey | PVGYYKBIUKOMTG-UHFFFAOYSA-N |
| Density | 1.277g/cm3 (Cal.) |
|---|---|
| Boiling point | 145.736°C at 760 mmHg (Cal.) |
| Flash point | 36.492°C (Cal.) |
| Refractive index | 1.451 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,1,2-Tetrachloro-2,2-Dimethyldisilane |