|
CAS#: 26988-61-4 Product: N-[S-Trityl-L-Cysteinyl]Glycine No suppilers available for the product. |
| Name | N-[S-Trityl-L-Cysteinyl]Glycine |
|---|---|
| Synonyms | 2-[[2-Amino-1-Oxo-3-[Tri(Phenyl)Methylthio]Propyl]Amino]Acetic Acid; 2-[[2-Amino-3-[Tri(Phenyl)Methylthio]Propanoyl]Amino]Acetic Acid; 2-[[2-Amino-3-[Tri(Phenyl)Methylsulfanyl]Propanoyl]Amino]Ethanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C24H24N2O3S |
| Molecular Weight | 420.53 |
| CAS Registry Number | 26988-61-4 |
| SMILES | C3=C(C(SCC(C(NCC(=O)O)=O)N)(C1=CC=CC=C1)C2=CC=CC=C2)C=CC=C3 |
| InChI | 1S/C24H24N2O3S/c25-21(23(29)26-16-22(27)28)17-30-24(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,21H,16-17,25H2,(H,26,29)(H,27,28) |
| InChIKey | CQWAYRTZXZSUEP-UHFFFAOYSA-N |
| Density | 1.259g/cm3 (Cal.) |
|---|---|
| Boiling point | 650.069°C at 760 mmHg (Cal.) |
| Flash point | 346.949°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[S-Trityl-L-Cysteinyl]Glycine |