|
CAS#: 27067-70-5 Product: 5-Hydroxyacronine No suppilers available for the product. |
| Name | 5-Hydroxyacronine |
|---|---|
| Synonyms | 6,11-Dihydroxy-3,3,12-Trimethyl-Pyrano[6,5-C]Acridin-7-One; 6,11-Dihydroxy-3,3,12-Trimethyl-7-Pyrano[6,5-C]Acridinone; Aids161807 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 |
| CAS Registry Number | 27067-70-5 |
| SMILES | C3=C(C1=C(N(C)C2=C(C1=O)C=CC=C2O)C4=C3OC(C)(C)C=C4)O |
| InChI | 1S/C19H17NO4/c1-19(2)8-7-10-14(24-19)9-13(22)15-17(10)20(3)16-11(18(15)23)5-4-6-12(16)21/h4-9,21-22H,1-3H3 |
| InChIKey | JZQDCDLYNFZBIG-UHFFFAOYSA-N |
| Density | 1.347g/cm3 (Cal.) |
|---|---|
| Boiling point | 564.369°C at 760 mmHg (Cal.) |
| Flash point | 295.12°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Hydroxyacronine |