|
CAS#: 2711-20-8 Product: 3-[2-Chloro-5-(Trifluoromethyl)Phenyl]-1,1-Dimethylurea No suppilers available for the product. |
| Name | 3-[2-Chloro-5-(Trifluoromethyl)Phenyl]-1,1-Dimethylurea |
|---|---|
| Synonyms | 3-[2-Chloro-5-(Trifluoromethyl)Phenyl]-1,1-Dimethyl-Urea; 3-(2-Chloro-5-(Trifluoromethyl)Phenyl)-1,1-Dimethylurea |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10ClF3N2O |
| Molecular Weight | 266.65 |
| CAS Registry Number | 2711-20-8 |
| EINECS | 220-305-4 |
| SMILES | C1=C(C=CC(=C1NC(N(C)C)=O)Cl)C(F)(F)F |
| InChI | 1S/C10H10ClF3N2O/c1-16(2)9(17)15-8-5-6(10(12,13)14)3-4-7(8)11/h3-5H,1-2H3,(H,15,17) |
| InChIKey | WPKYGXCUDANURX-UHFFFAOYSA-N |
| Density | 1.391g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.766°C at 760 mmHg (Cal.) |
| Flash point | 162.309°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-[2-Chloro-5-(Trifluoromethyl)Phenyl]-1,1-Dimethylurea |