|
CAS#: 27137-86-6 Product: Trichloro(Trichlorophenyl)Silane No suppilers available for the product. |
| Name | Trichloro(Trichlorophenyl)Silane |
|---|---|
| Synonyms | Trichloro(Trichlorophenyl)Silane |
| Molecular Structure | ![]() |
| Molecular Formula | C6H2Cl6Si |
| Molecular Weight | 314.89 |
| CAS Registry Number | 27137-86-6 |
| EINECS | 248-255-9 |
| SMILES | C1=CC(=C(Cl)C(=C1Cl)Cl)[Si](Cl)(Cl)Cl |
| InChI | 1S/C6H2Cl6Si/c7-3-1-2-4(13(10,11)12)6(9)5(3)8/h1-2H |
| InChIKey | SPOAMBDEEBRZSZ-UHFFFAOYSA-N |
| Density | 1.625g/cm3 (Cal.) |
|---|---|
| Boiling point | 285.856°C at 760 mmHg (Cal.) |
| Flash point | 138.725°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trichloro(Trichlorophenyl)Silane |