|
CAS#: 27159-78-0 Product: N1,N1-Dimethyl-N2-(1-Phenylethyl)Formamidine No suppilers available for the product. |
| Name | N1,N1-Dimethyl-N2-(1-Phenylethyl)Formamidine |
|---|---|
| Synonyms | N,N-Dimethyl-N'-(1-Phenylethyl)Formamidine; N,N-Dimethyl-N'-(Alpha-Methylbenzyl)-Formamidine; Brn 2830533 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 |
| CAS Registry Number | 27159-78-0 |
| SMILES | C1=C(C(N=CN(C)C)C)C=CC=C1 |
| InChI | 1S/C11H16N2/c1-10(12-9-13(2)3)11-7-5-4-6-8-11/h4-10H,1-3H3 |
| InChIKey | CELOCTORSPYCHU-UHFFFAOYSA-N |
| Density | 0.909g/cm3 (Cal.) |
|---|---|
| Boiling point | 244.987°C at 760 mmHg (Cal.) |
| Flash point | 101.965°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N1,N1-Dimethyl-N2-(1-Phenylethyl)Formamidine |