|
CAS#: 2720-79-8 Product: Potassium Phenylmethoxymethanedithioate No suppilers available for the product. |
| Name | Potassium Phenylmethoxymethanedithioate |
|---|---|
| Synonyms | Potassium Benzyloxymethanedithioate; Potassium Benzoxymethanedithioate; Carbonodithioic Acid, O-(Phenylmethyl)Ester, Potassium Salt (9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7KOS2 |
| Molecular Weight | 222.36 |
| CAS Registry Number | 2720-79-8 |
| SMILES | C1=C(COC([S-])=S)C=CC=C1.[K+] |
| InChI | 1S/C8H8OS2.K/c10-8(11)9-6-7-4-2-1-3-5-7;/h1-5H,6H2,(H,10,11);/q;+1/p-1 |
| InChIKey | NIONVQFBKDTMHR-UHFFFAOYSA-M |
| Boiling point | 260.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 111.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Potassium Phenylmethoxymethanedithioate |