| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| ChemPacific Corp | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| Szintekon Co, Ltd. | Hungary | Inquire | ||
|---|---|---|---|---|
![]() |
info@szintekon.hu | |||
| Chemical manufacturer since 1996 | ||||
| ZereneX Molecular Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | 1,5-Diphenyl-3-(Trifluoromethyl)-1H-Pyrazole |
|---|---|
| Synonyms | ########; 1,5-Diphenyl-3-(trifluormethyl)-1H-pyrazol |
| Molecular Structure | ![]() |
| Molecular Formula | C16H11F3N2 |
| Molecular Weight | 288.27 |
| CAS Registry Number | 2730-02-1 |
| SMILES | C1=CC=C(C=C1)C2=CC(=NN2C3=CC=CC=C3)C(F)(F)F |
| InChI | 1S/C16H11F3N2/c17-16(18,19)15-11-14(12-7-3-1-4-8-12)21(20-15)13-9-5-2-6-10-13/h1-11H |
| InChIKey | QSQASSUNYGTMLF-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.5±42.0°C at 760 mmHg (Cal.) |
| Flash point | 185.7±27.9°C (Cal.) |
| Refractive index | 1.56 (Cal.) |
| (1) | Timothy Norris, Roberto Colon-Cruz and David H. B. Ripin. New hydroxy-pyrazoline intermediates, subtle regio-selectivity and relative reaction rate variations observed during acid catalyzed and neutral pyrazole cyclization, Org. Biomol. Chem., 2005, 3, 1844. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,5-Diphenyl-3-(Trifluoromethyl)-1H-Pyrazole |