Online Database of Chemicals from Around the World
|
CAS#: 2732-09-4 Product: 9-Methylnaphtho[1,2-b]Quinoline-7-Carbaldehyde No suppilers available for the product. |
| Name | 9-Methylnaphtho[1,2-b]Quinoline-7-Carbaldehyde |
|---|---|
| Synonyms | 9-Methyl-7-Naphtho[1,2-B]Quinolinecarboxaldehyde; 5-21-09-00333 (Beilstein Handbook Reference); 7-Formyl-9-Methylbenz(C)Acridine |
| Molecular Structure | ![CAS#: 2732-09-4, 9-Methylnaphtho[1,2-b]Quinoline-7-Carbaldehyde](/moreStructures/2732-09-4.gif) |
| Molecular Formula | C19H13NO |
| Molecular Weight | 271.32 |
| CAS Registry Number | 2732-09-4 |
| SMILES | C2=CC4=C(C3=NC1=CC=C(C=C1C(=C23)C=O)C)C=CC=C4 |
| InChI | 1S/C19H13NO/c1-12-6-9-18-16(10-12)17(11-21)15-8-7-13-4-2-3-5-14(13)19(15)20-18/h2-11H,1H3 |
| InChIKey | CLAQKFCRXYBNSM-UHFFFAOYSA-N |
| Density | 1.274g/cm3 (Cal.) |
|---|---|
| Boiling point | 517.852°C at 760 mmHg (Cal.) |
| Flash point | 266.941°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Methylnaphtho[1,2-b]Quinoline-7-Carbaldehyde |