|
CAS#: 27345-71-7 Product: trans-Hexahydro-2(3H)-Benzofuranone No suppilers available for the product. |
| Name | trans-Hexahydro-2(3H)-Benzofuranone |
|---|---|
| Synonyms | (3Ar,7As)-3A,4,5,6,7,7A-Hexahydro-3H-Benzofuran-2-One; Nsc126359; Nsc6501 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 |
| CAS Registry Number | 27345-71-7 |
| SMILES | [C@@H]12OC(=O)C[C@H]1CCCC2 |
| InChI | 1S/C8H12O2/c9-8-5-6-3-1-2-4-7(6)10-8/h6-7H,1-5H2/t6-,7+/m1/s1 |
| InChIKey | AQKZNTBBGPQPBG-RQJHMYQMSA-N |
| Density | 1.093g/cm3 (Cal.) |
|---|---|
| Boiling point | 262.767°C at 760 mmHg (Cal.) |
| Flash point | 103.833°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for trans-Hexahydro-2(3H)-Benzofuranone |