|
CAS#: 27354-06-9 Product: 5-Hydroxy-1,4-Dihydro-9,10-Anthracenedione No suppilers available for the product. |
| Name | 5-Hydroxy-1,4-Dihydro-9,10-Anthracenedione |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C14H10O3 |
| Molecular Weight | 226.23 |
| CAS Registry Number | 27354-06-9 |
| SMILES | O=C\2c1c(c(O)ccc1)C(=O)/C3=C/2C/C=C\C3 |
| InChI | 1S/C14H10O3/c15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16/h1-3,6-7,15H,4-5H2 |
| InChIKey | HFWPWLIIOYAVNE-UHFFFAOYSA-N |
| Density | 1.405g/cm3 (Cal.) |
|---|---|
| Boiling point | 463.121°C at 760 mmHg (Cal.) |
| Flash point | 248.006°C (Cal.) |
| Refractive index | 1.68 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Hydroxy-1,4-Dihydro-9,10-Anthracenedione |