| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2-Succinylbenzoic Acid |
|---|---|
| Synonyms | 2-(4-Hydroxy-4-Oxo-Butanoyl)Benzoic Acid; 2-(4-Hydroxy-1,4-Dioxobutyl)Benzoic Acid; 2-(4-Hydroxy-4-Keto-Butanoyl)Benzoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10O5 |
| Molecular Weight | 222.20 |
| CAS Registry Number | 27415-09-4 |
| SMILES | C1=CC=CC(=C1C(O)=O)C(CCC(=O)O)=O |
| InChI | 1S/C11H10O5/c12-9(5-6-10(13)14)7-3-1-2-4-8(7)11(15)16/h1-4H,5-6H2,(H,13,14)(H,15,16) |
| InChIKey | YIVWQNVQRXFZJB-UHFFFAOYSA-N |
| Density | 1.379g/cm3 (Cal.) |
|---|---|
| Boiling point | 486.457°C at 760 mmHg (Cal.) |
| Flash point | 262.104°C (Cal.) |
| (1) | Song et al.. Prediction and assignment of function for a divergent N-succinyl amino acid racemase, Nature Chemical Biology, 2007 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Succinylbenzoic Acid |