|
CAS#: 27451-20-3 Product: N,O-Diacetyl-N-(4-Methylphenyl)Hydroxylamine No suppilers available for the product. |
| Name | N,O-Diacetyl-N-(4-Methylphenyl)Hydroxylamine |
|---|---|
| Synonyms | Acetic Acid [Acetyl-(4-Methylphenyl)Amino] Ester; [Ethanoyl-(4-Methylphenyl)Amino] Ethanoate; Acetohydroxamic Acid, N-(P-Tolyl)-, Acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 |
| CAS Registry Number | 27451-20-3 |
| SMILES | C1=C(N(OC(C)=O)C(C)=O)C=CC(=C1)C |
| InChI | 1S/C11H13NO3/c1-8-4-6-11(7-5-8)12(9(2)13)15-10(3)14/h4-7H,1-3H3 |
| InChIKey | PEKFEIHUDPOPHA-UHFFFAOYSA-N |
| Density | 1.169g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.457°C at 760 mmHg (Cal.) |
| Flash point | 138.536°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,O-Diacetyl-N-(4-Methylphenyl)Hydroxylamine |