|
CAS#: 27506-82-7 Product: 1,3-Bis(Acetoxymethyl)-5,5-Diethylbarbituric Acid No suppilers available for the product. |
| Name | 1,3-Bis(Acetoxymethyl)-5,5-Diethylbarbituric Acid |
|---|---|
| Synonyms | [3-(Acetoxymethyl)-5,5-Diethyl-2,4,6-Trioxo-Hexahydropyrimidin-1-Yl]Methyl Acetate; Acetic Acid [3-(Acetoxymethyl)-5,5-Diethyl-2,4,6-Trioxo-1-Hexahydropyrimidinyl]Methyl Ester; Acetic Acid [3-(Acetoxymethyl)-5,5-Diethyl-2,4,6-Triketo-Hexahydropyrimidin-1-Yl]Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20N2O7 |
| Molecular Weight | 328.32 |
| CAS Registry Number | 27506-82-7 |
| SMILES | C(C1(C(N(C(N(C1=O)COC(C)=O)=O)COC(C)=O)=O)CC)C |
| InChI | 1S/C14H20N2O7/c1-5-14(6-2)11(19)15(7-22-9(3)17)13(21)16(12(14)20)8-23-10(4)18/h5-8H2,1-4H3 |
| InChIKey | RIRXYASKYWHVTR-UHFFFAOYSA-N |
| Density | 1.231g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.327°C at 760 mmHg (Cal.) |
| Flash point | 206.192°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Bis(Acetoxymethyl)-5,5-Diethylbarbituric Acid |