| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 5-Allyl-5-Isopropyl-1,3-Dimethyl-2,4,6(1H,3H,5H)-Pyrimidinetrione |
|---|---|
| Synonyms | 1,3-Dimethyl derivative of Aprobarbital; 5-Allyl-5 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.28 |
| CAS Registry Number | 27509-65-5 |
| SMILES | O=C1N(C(=O)C(C(=O)N1C)(C\C=C)C(C)C)C |
| InChI | 1S/C12H18N2O3/c1-6-7-12(8(2)3)9(15)13(4)11(17)14(5)10(12)16/h6,8H,1,7H2,2-5H3 |
| InChIKey | VWSMYPQLKQLMPN-UHFFFAOYSA-N |
| Density | 1.094g/cm3 (Cal.) |
|---|---|
| Boiling point | 300.818°C at 760 mmHg (Cal.) |
| Flash point | 111.958°C (Cal.) |
| Refractive index | 1.489 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Allyl-5-Isopropyl-1,3-Dimethyl-2,4,6(1H,3H,5H)-Pyrimidinetrione |