|
CAS#: 27534-93-6 Product: 4-Pregnen-7alpha-Ol-3,20-Dione No suppilers available for the product. |
| Name | 4-Pregnen-7alpha-Ol-3,20-Dione |
|---|---|
| Synonyms | (8S,9S,10R,13S,14S,17S)-17-Ethanoyl-7-Hydroxy-10,13-Dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-Dodecahydrocyclopenta[A]Phenanthren-3-One; 7-Hydroxyprogesterone; 7Alpha-Hydroxyprogesterone |
| Molecular Structure | ![]() |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 |
| CAS Registry Number | 27534-93-6 |
| SMILES | [C@@H]23C(CC1=CC(CC[C@@]1([C@H]2CC[C@]4([C@H]3CC[C@@H]4C(=O)C)C)C)=O)O |
| InChI | 1S/C21H30O3/c1-12(22)15-4-5-16-19-17(7-9-21(15,16)3)20(2)8-6-14(23)10-13(20)11-18(19)24/h10,15-19,24H,4-9,11H2,1-3H3/t15-,16+,17+,18?,19+,20+,21-/m1/s1 |
| InChIKey | QRDYCDIUGUAUBZ-CWNZLVRBSA-N |
| Density | 1.152g/cm3 (Cal.) |
|---|---|
| Boiling point | 489.056°C at 760 mmHg (Cal.) |
| Flash point | 263.674°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Pregnen-7alpha-Ol-3,20-Dione |