|
CAS#: 275795-16-9 Product: 3-Tert-Butyl-4-Nitrosobiphenyl No suppilers available for the product. |
| Name | 3-Tert-Butyl-4-Nitrosobiphenyl |
|---|---|
| Synonyms | 2-Tert-Butyl-1-Nitroso-4-Phenyl-Benzene; 3-(1,1-Dimethylethyl)-4-Nitroso-1,1'-Biphenyl; Ccris 8748 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 |
| CAS Registry Number | 275795-16-9 |
| SMILES | C2=C(C1=CC=CC=C1)C=CC(=C2C(C)(C)C)N=O |
| InChI | 1S/C16H17NO/c1-16(2,3)14-11-13(9-10-15(14)17-18)12-7-5-4-6-8-12/h4-11H,1-3H3 |
| InChIKey | VJANPCXLBDGFCT-UHFFFAOYSA-N |
| Density | 1.006g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.613°C at 760 mmHg (Cal.) |
| Flash point | 154.128°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Tert-Butyl-4-Nitrosobiphenyl |