|
CAS#: 27683-73-4 Product: 4-Chloro-2'-[(methylamino)methyl]benzhydrol hydrochloride No suppilers available for the product. |
| Name | 4-Chloro-2'-[(methylamino)methyl]benzhydrol hydrochloride |
|---|---|
| Synonyms | Pr-F-36-Cl; Setazindol Hydrochloride; 4-Chlor-2-((Methylamino)-Methyl)-Benzhydrol-Hydrochlorid [German] |
| Molecular Structure | ![]() |
| Molecular Formula | C15H17Cl2NO |
| Molecular Weight | 298.21 |
| CAS Registry Number | 27683-73-4 |
| SMILES | [H+].C2=C(C(O)C1=CC=C(Cl)C=C1)C(=CC=C2)CNC.[Cl-] |
| InChI | 1S/C15H16ClNO.ClH/c1-17-10-12-4-2-3-5-14(12)15(18)11-6-8-13(16)9-7-11;/h2-9,15,17-18H,10H2,1H3;1H |
| InChIKey | JOKHHLKHNMKCON-UHFFFAOYSA-N |
| Boiling point | 396°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 193.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-2'-[(methylamino)methyl]benzhydrol hydrochloride |