|
CAS#: 276877-80-6 Product: trans-1-Propyl-4-Vinylcyclohexane No suppilers available for the product. |
| Name | trans-1-Propyl-4-Vinylcyclohexane |
|---|---|
| Synonyms | trans-1-Propyl-4-vinyl-cyclohexane |
| Molecular Structure | ![]() |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 |
| CAS Registry Number | 276877-80-6 |
| SMILES | CCC[C@H]1CC[C@@H](CC1)C=C |
| InChI | 1S/C11H20/c1-3-5-11-8-6-10(4-2)7-9-11/h4,10-11H,2-3,5-9H2,1H3/t10-,11- |
| InChIKey | WQLMITAVFBXRKU-XYPYZODXSA-N |
| Density | 0.84g/cm3 (Cal.) |
|---|---|
| Boiling point | 190.291°C at 760 mmHg (Cal.) |
| Flash point | 57.198°C (Cal.) |
| Refractive index | 1.49 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for trans-1-Propyl-4-Vinylcyclohexane |