Online Database of Chemicals from Around the World
|
CAS#: 27748-04-5 Product: 4-(3-Tert-Butylamino-2-Hydroxypropoxy)-2-Carboxyindole No suppilers available for the product. |
| Name | 4-(3-Tert-Butylamino-2-Hydroxypropoxy)-2-Carboxyindole |
|---|---|
| Synonyms | 4-[3-(Tert-Butylamino)-2-Hydroxy-Propoxy]-1H-Indole-2-Carboxylic Acid; 1H-Indole-2-Carboxylic Acid, 4-(3-((1,1-Dimethylethyl)Amino)-2-Hydroxypropoxy)-; 4-(3-Tert-Butylamino-2-Hydroxypropoxy)-2-Carboxyindole |
| Molecular Structure |  |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 |
| CAS Registry Number | 27748-04-5 |
| SMILES | C1=C([NH]C2=C1C(=CC=C2)OCC(O)CNC(C)(C)C)C(=O)O |
| InChI | 1S/C16H22N2O4/c1-16(2,3)17-8-10(19)9-22-14-6-4-5-12-11(14)7-13(18-12)15(20)21/h4-7,10,17-19H,8-9H2,1-3H3,(H,20,21) |
| InChIKey | XYDHEGOVFRXKOO-UHFFFAOYSA-N |
| Density | 1.255g/cm3 (Cal.) |
|---|---|
| Boiling point | 566.083°C at 760 mmHg (Cal.) |
| Flash point | 296.156°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(3-Tert-Butylamino-2-Hydroxypropoxy)-2-Carboxyindole |