|
CAS#: 27758-96-9 Product: 1,2-Bis[(E)-2-Phenylvinyl]Benzene No suppilers available for the product. |
| Name | 1,2-Bis[(E)-2-Phenylvinyl]Benzene |
|---|---|
| Synonyms | trans-distyrylbenzene |
| Molecular Structure | ![]() |
| Molecular Formula | C22H18 |
| Molecular Weight | 282.38 |
| CAS Registry Number | 27758-96-9 |
| SMILES | C1=CC=C(C=C1)/C=C/C2=CC=CC=C2/C=C/C3=CC=CC=C3 |
| InChI | 1S/C22H18/c1-3-9-19(10-4-1)15-17-21-13-7-8-14-22(21)18-16-20-11-5-2-6-12-20/h1-18H/b17-15+,18-16+ |
| InChIKey | NGQSLSMAEVWNPU-YTEMWHBBSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.0±30.0°C at 760 mmHg (Cal.) |
| Flash point | 215.5±18.7°C (Cal.) |
| Refractive index | 1.72 (Cal.) |
| (1) | Elisabetta Collini, Ilaria Fortunati, Sara Scolaro, Raffaella Signorini, Camilla Ferrante, Renato Bozio, Graziano Fabbrini, Michele Maggini, Emiliano Rossi and Simone Silvestrini. A fullerene–distyrylbenzene photosensitizer for two-photon promoted singlet oxygen production, Phys. Chem. Chem. Phys., 2010, 12, 4656. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,2-Bis[(E)-2-Phenylvinyl]Benzene |