|
CAS#: 2776-36-5 Product: (2S)-2-Amino-3-[4-(Diaminomethylideneamino)Phenyl]Propanoic Acid No suppilers available for the product. |
| Name | (2S)-2-Amino-3-[4-(Diaminomethylideneamino)Phenyl]Propanoic Acid |
|---|---|
| Synonyms | (2S)-2-Amino-3-(4-Guanidinophenyl)Propanoic Acid; (2S)-2-Amino-3-(4-Guanidinophenyl)Propionic Acid; Phenylalanine, 4-((Aminoiminomethyl)Amino)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 |
| CAS Registry Number | 2776-36-5 |
| SMILES | [C@H](N)(CC1=CC=C(N=C(N)N)C=C1)C(O)=O |
| InChI | 1S/C10H14N4O2/c11-8(9(15)16)5-6-1-3-7(4-2-6)14-10(12)13/h1-4,8H,5,11H2,(H,15,16)(H4,12,13,14)/t8-/m0/s1 |
| InChIKey | FYMNTAQFDTZISY-QMMMGPOBSA-N |
| Density | 1.436g/cm3 (Cal.) |
|---|---|
| Boiling point | 479.664°C at 760 mmHg (Cal.) |
| Flash point | 243.892°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-2-Amino-3-[4-(Diaminomethylideneamino)Phenyl]Propanoic Acid |