|
CAS#: 2779-18-2 Product: 3,22-Dioxo-Vobasan-17-oic acid methyl ester No suppilers available for the product. |
| Name | 3,22-Dioxo-Vobasan-17-oic acid methyl ester |
|---|---|
| Synonyms | Aids-058062; Periformyline; Vobasan-17-Oic Acid, 3,22-Dioxo-, Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 |
| CAS Registry Number | 2779-18-2 |
| SMILES | [C@@H]14N(CC(/[C@@H]([C@@H]1C(OC)=O)CC(=O)C3=C(C2=CC=CC=C2[NH]3)C4)=C/C)C=O |
| InChI | 1S/C21H22N2O4/c1-3-12-10-23(11-24)17-8-15-13-6-4-5-7-16(13)22-20(15)18(25)9-14(12)19(17)21(26)27-2/h3-7,11,14,17,19,22H,8-10H2,1-2H3/b12-3-/t14-,17-,19-/m0/s1 |
| InChIKey | NHUKMNGLSAXGDK-HROPKPTCSA-N |
| Density | 1.37g/cm3 (Cal.) |
|---|---|
| Boiling point | 601.404°C at 760 mmHg (Cal.) |
| Flash point | 317.518°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,22-Dioxo-Vobasan-17-oic acid methyl ester |