|
CAS#: 27798-59-0 Product: Methyl 3,5-Bis[(Trimethylsilyl)Oxy]Benzoate No suppilers available for the product. |
| Name | Methyl 3,5-Bis[(Trimethylsilyl)Oxy]Benzoate |
|---|---|
| Synonyms | Methyl 3,5-bis[(trimethylsilyl)oxy]benzoate; Methyl es |
| Molecular Structure | ![]() |
| Molecular Formula | C14H24O4Si2 |
| Molecular Weight | 312.51 |
| CAS Registry Number | 27798-59-0 |
| SMILES | O=C(OC)c1cc(O[Si](C)(C)C)cc(O[Si](C)(C)C)c1 |
| InChI | 1S/C14H24O4Si2/c1-16-14(15)11-8-12(17-19(2,3)4)10-13(9-11)18-20(5,6)7/h8-10H,1-7H3 |
| InChIKey | JTVXXCSEPSMUDA-UHFFFAOYSA-N |
| Density | 0.999g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.681°C at 760 mmHg (Cal.) |
| Flash point | 121.806°C (Cal.) |
| Refractive index | 1.47 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 3,5-Bis[(Trimethylsilyl)Oxy]Benzoate |