|
CAS#: 27842-38-2 Product: 3-(Dimethylamino)-1-Hydroxy-1,1-Diphenyl-2-Propanone No suppilers available for the product. |
| Name | 3-(Dimethylamino)-1-Hydroxy-1,1-Diphenyl-2-Propanone |
|---|---|
| Synonyms | 3-Dimethylamino-1-Hydroxy-1,1-Di(Phenyl)Acetone; Brn 2812455; 2-Propanone, 3-Dimethylamino-1,1-Diphenyl-1-Hydroxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 |
| CAS Registry Number | 27842-38-2 |
| SMILES | C1=CC=CC=C1C(C(CN(C)C)=O)(C2=CC=CC=C2)O |
| InChI | 1S/C17H19NO2/c1-18(2)13-16(19)17(20,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,20H,13H2,1-2H3 |
| InChIKey | FZGVCLIXODMNBV-UHFFFAOYSA-N |
| Density | 1.134g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.256°C at 760 mmHg (Cal.) |
| Flash point | 194.054°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Dimethylamino)-1-Hydroxy-1,1-Diphenyl-2-Propanone |