|
CAS#: 2786-43-8 Product: 3-Methyl-1,3-Benzothiazole-2-Selone No suppilers available for the product. |
| Name | 3-Methyl-1,3-Benzothiazole-2-Selone |
|---|---|
| Synonyms | 2(3H)-Benzothiazoleselone, 3-Methyl-; 3-Methyl-2-Selenoxobenzothiazole; 3-Methylbenzothiazole-2(3H)-Selone |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7NSSe |
| Molecular Weight | 228.17 |
| CAS Registry Number | 2786-43-8 |
| EINECS | 220-506-7 |
| SMILES | C1=CC=CC2=C1N(C)C(=[Se])S2 |
| InChI | 1S/C8H7NSSe/c1-9-6-4-2-3-5-7(6)10-8(9)11/h2-5H,1H3 |
| InChIKey | VBKDUIRAXCKPOA-UHFFFAOYSA-N |
| Boiling point | 328.423°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 152.425°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-1,3-Benzothiazole-2-Selone |