|
CAS#: 27932-00-9 Product: (2,3-Dihydro-1H-Inden-5-Yl) Hydrogen Phenylmalonate No suppilers available for the product. |
| Name | (2,3-Dihydro-1H-Inden-5-Yl) Hydrogen Phenylmalonate |
|---|---|
| Synonyms | 3-Indan-5-Yloxy-3-Oxo-2-Phenyl-Propanoic Acid; 3-(5-Indanyloxy)-3-Oxo-2-Phenylpropanoic Acid; 3-Indan-5-Yloxy-3-Keto-2-Phenyl-Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.32 |
| CAS Registry Number | 27932-00-9 |
| EINECS | 248-736-3 |
| SMILES | C1=C3C(=CC=C1OC(C(C(=O)O)C2=CC=CC=C2)=O)CCC3 |
| InChI | 1S/C18H16O4/c19-17(20)16(13-5-2-1-3-6-13)18(21)22-15-10-9-12-7-4-8-14(12)11-15/h1-3,5-6,9-11,16H,4,7-8H2,(H,19,20) |
| InChIKey | ZPIUANRTQSWZBQ-UHFFFAOYSA-N |
| Density | 1.295g/cm3 (Cal.) |
|---|---|
| Boiling point | 504.404°C at 760 mmHg (Cal.) |
| Flash point | 186.75°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,3-Dihydro-1H-Inden-5-Yl) Hydrogen Phenylmalonate |