|
CAS#: 2795-55-3 Product: 3,7-Difluoro-2-Nitro-9H-Fluorene No suppilers available for the product. |
| Name | 3,7-Difluoro-2-Nitro-9H-Fluorene |
|---|---|
| Synonyms | Nsc57475 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H7F2NO2 |
| Molecular Weight | 247.20 |
| CAS Registry Number | 2795-55-3 |
| SMILES | C1=C([N+]([O-])=O)C(=CC2=C1CC3=C2C=CC(=C3)F)F |
| InChI | 1S/C13H7F2NO2/c14-9-1-2-10-7(4-9)3-8-5-13(16(17)18)12(15)6-11(8)10/h1-2,4-6H,3H2 |
| InChIKey | JKNITGKNXVGUOQ-UHFFFAOYSA-N |
| Density | 1.466g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.163°C at 760 mmHg (Cal.) |
| Flash point | 234.592°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,7-Difluoro-2-Nitro-9H-Fluorene |