|
CAS#: 27978-16-1 Product: 4-Ethylthioacetanilide No suppilers available for the product. |
| Name | 4-Ethylthioacetanilide |
|---|---|
| Synonyms | N-[4-(Ethylthio)Phenyl]Acetamide; N-(4-Ethylsulfanylphenyl)Ethanamide; 1-13-00-00202 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.28 |
| CAS Registry Number | 27978-16-1 |
| SMILES | C1=C(C=CC(=C1)SCC)NC(C)=O |
| InChI | 1S/C10H13NOS/c1-3-13-10-6-4-9(5-7-10)11-8(2)12/h4-7H,3H2,1-2H3,(H,11,12) |
| InChIKey | OZEDCQKEELTOTC-UHFFFAOYSA-N |
| Density | 1.12g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.475°C at 760 mmHg (Cal.) |
| Flash point | 183.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Ethylthioacetanilide |