|
CAS#: 27979-57-3 Product: 5,7-Dihydroxy-4-Methyl-2-Benzofuran-1(3H)-One No suppilers available for the product. |
| Name | 5,7-Dihydroxy-4-Methyl-2-Benzofuran-1(3H)-One |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.16 |
| CAS Registry Number | 27979-57-3 |
| SMILES | CC1=C2COC(=O)C2=C(C=C1O)O |
| InChI | 1S/C9H8O4/c1-4-5-3-13-9(12)8(5)7(11)2-6(4)10/h2,10-11H,3H2,1H3 |
| InChIKey | GXYQICKPCCBIIX-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 486.0±44.0°C at 760 mmHg (Cal.) |
| Flash point | 206.9±21.9°C (Cal.) |
| Refractive index | 1.663 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,7-Dihydroxy-4-Methyl-2-Benzofuran-1(3H)-One |