|
CAS#: 28030-27-5 Product: Methyl 1-Methyl-4-Phenyl-4-Piperidinecarboxylate No suppilers available for the product. |
| Name | Methyl 1-Methyl-4-Phenyl-4-Piperidinecarboxylate |
|---|---|
| Synonyms | Methyl 1-methyl-4-phenyl-4-piperidinecarboxylate # |
| Molecular Structure | ![]() |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 |
| CAS Registry Number | 28030-27-5 |
| SMILES | O=C(OC)C2(c1ccccc1)CCN(C)CC2 |
| InChI | 1S/C14H19NO2/c1-15-10-8-14(9-11-15,13(16)17-2)12-6-4-3-5-7-12/h3-7H,8-11H2,1-2H3 |
| InChIKey | QMLOWOUGKNJFEK-UHFFFAOYSA-N |
| Density | 1.072g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.688°C at 760 mmHg (Cal.) |
| Flash point | 109.463°C (Cal.) |
| Refractive index | 1.524 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 1-Methyl-4-Phenyl-4-Piperidinecarboxylate |