Online Database of Chemicals from Around the World
| Name | 4,4'-Bis[2-(2-hydroxyethoxy)ethoxy]octachlorobiphenyl |
|---|---|
| Synonyms | 2,2'-((2,2',3,3',5,5',6,6'-Octachloro(1,1'-Biphenyl)-4,4'-Diyl)Bis(Oxyethane-2,1-Diyloxy))Bisethanol |
| Molecular Structure | ![CAS#: 28031-44-9, 4,4'-Bis[2-(2-hydroxyethoxy)ethoxy]octachlorobiphenyl](/moreStructures/28031-44-9.gif) |
| Molecular Formula | C20H18Cl8O6 |
| Molecular Weight | 637.98 |
| CAS Registry Number | 28031-44-9 |
| EINECS | 248-790-8 |
| SMILES | C(OC2=C(C(=C(C1=C(C(=C(C(=C1Cl)Cl)OCCOCCO)Cl)Cl)C(=C2Cl)Cl)Cl)Cl)COCCO |
| InChI | 1S/C20H18Cl8O6/c21-11-9(12(22)16(26)19(15(11)25)33-7-5-31-3-1-29)10-13(23)17(27)20(18(28)14(10)24)34-8-6-32-4-2-30/h29-30H,1-8H2 |
| InChIKey | JCAKQWYCRZDXTP-UHFFFAOYSA-N |
| Density | 1.575g/cm3 (Cal.) |
|---|---|
| Boiling point | 681.016°C at 760 mmHg (Cal.) |
| Flash point | 365.666°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-Bis[2-(2-hydroxyethoxy)ethoxy]octachlorobiphenyl |
