|
CAS#: 28057-58-1 Product: D-erythro-2,3-Hexodiulose No suppilers available for the product. |
| Name | D-erythro-2,3-Hexodiulose |
|---|---|
| Synonyms | 3-Ketofructose; D-Erythro-2,3-Hexodiulose |
| Molecular Structure | ![]() |
| Molecular Formula | C6H10O6 |
| Molecular Weight | 178.14 |
| CAS Registry Number | 28057-58-1 |
| SMILES | [C@@H](O)([C@H](O)CO)C(C(CO)=O)=O |
| InChI | 1S/C6H10O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5,7-9,11H,1-2H2/t3-,5-/m1/s1 |
| InChIKey | ZJLNMPGCXVVXDR-NQXXGFSBSA-N |
| Density | 1.582g/cm3 (Cal.) |
|---|---|
| Boiling point | 463.127°C at 760 mmHg (Cal.) |
| Flash point | 248.01°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for D-erythro-2,3-Hexodiulose |