|
CAS#: 2808-46-0 Product: 5,8-Dihydroxy-2,7-Dimethoxynaphthalene-1,4-Dione No suppilers available for the product. |
| Name | 5,8-Dihydroxy-2,7-Dimethoxynaphthalene-1,4-Dione |
|---|---|
| Synonyms | 5,8-Dihydroxy-2,7-Dimethoxy-Naphthalene-1,4-Dione; 5,8-Dihydroxy-2,7-Dimethoxy-1,4-Naphthoquinone; 1,4-Naphthalenedione, 5,8-Dihydroxy-2,7-Dimethoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10O6 |
| Molecular Weight | 250.21 |
| CAS Registry Number | 2808-46-0 |
| SMILES | C2=C(C1=C(C(C(=CC1=O)OC)=O)C(=C2OC)O)O |
| InChI | 1S/C12H10O6/c1-17-7-3-5(13)9-6(14)4-8(18-2)12(16)10(9)11(7)15/h3-4,13,15H,1-2H3 |
| InChIKey | OKTQTRCTZAALBF-UHFFFAOYSA-N |
| Density | 1.536g/cm3 (Cal.) |
|---|---|
| Boiling point | 579.662°C at 760 mmHg (Cal.) |
| Flash point | 231.416°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,8-Dihydroxy-2,7-Dimethoxynaphthalene-1,4-Dione |