|
CAS#: 28088-73-5 Product: 3,3',4,4',5,5'-Hexanitro-2,2'-Biphenyldiamine No suppilers available for the product. |
| Name | 3,3',4,4',5,5'-Hexanitro-2,2'-Biphenyldiamine |
|---|---|
| Synonyms | hexanitrobiphenyldiamine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6N8O12 |
| Molecular Weight | 454.22 |
| CAS Registry Number | 28088-73-5 |
| EINECS | 248-830-4 |
| SMILES | Nc2c(c(c(cc2c1cc([N+]([O-])=O)c([N+]([O-])=O)c(c1N)[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C12H6N8O12/c13-7-3(1-5(15(21)22)9(17(25)26)11(7)19(29)30)4-2-6(16(23)24)10(18(27)28)12(8(4)14)20(31)32/h1-2H,13-14H2 |
| InChIKey | UKFLKXPAZWYTJP-UHFFFAOYSA-N |
| Density | 1.972g/cm3 (Cal.) |
|---|---|
| Boiling point | 841.827°C at 760 mmHg (Cal.) |
| Flash point | 462.92°C (Cal.) |
| Refractive index | 1.801 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3',4,4',5,5'-Hexanitro-2,2'-Biphenyldiamine |