| Name | (2-Hydroxyethyl)Dimethylammonium 2-(4-Chlorophenoxy)-2-Methylpropionate |
|---|---|
| Synonyms | 3-(4-Chlorophenoxy)-2-Methyl-Propanoic Acid; 2-Dimethylaminoethanol; 3-(4-Chlorophenoxy)-2-Methyl-Propionic Acid; 2-Dimethylaminoethanol; 3-(P-Chlorophenoxy)-2-Methylpropionic Acid, Compound With 2-(Dimethylamino)Ethanol (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22ClNO4 |
| Molecular Weight | 303.79 |
| CAS Registry Number | 28100-39-2 |
| EINECS | 248-843-5 |
| SMILES | C1=C(OCC(C(=O)O)C)C=CC(=C1)Cl.C(N(C)C)CO |
| InChI | 1S/C10H11ClO3.C4H11NO/c1-7(10(12)13)6-14-9-4-2-8(11)3-5-9;1-5(2)3-4-6/h2-5,7H,6H2,1H3,(H,12,13);6H,3-4H2,1-2H3 |
| InChIKey | VIHNYAXGUFTKSQ-UHFFFAOYSA-N |
| Boiling point | 314.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 144.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Hydroxyethyl)Dimethylammonium 2-(4-Chlorophenoxy)-2-Methylpropionate |