|
CAS#: 28122-95-4 Product: Thiophene-2-Carbothioic Acid S-Phenyl Ester No suppilers available for the product. |
| Name | Thiophene-2-Carbothioic Acid S-Phenyl Ester |
|---|---|
| Synonyms | 2-Thiophenecarbothioic Acid S-Phenyl Ester; Thiophene-2-Carbothioic Acid S-Phenyl Ester; 2-Thiophenecarboxylic Acid, Thio-, S-Phenyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C11H8OS2 |
| Molecular Weight | 220.30 |
| CAS Registry Number | 28122-95-4 |
| SMILES | C1=C(SC=C1)C(=O)SC2=CC=CC=C2 |
| InChI | 1S/C11H8OS2/c12-11(10-7-4-8-13-10)14-9-5-2-1-3-6-9/h1-8H |
| InChIKey | XZYGCCMNPDMMIU-UHFFFAOYSA-N |
| Density | 1.31g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.393°C at 760 mmHg (Cal.) |
| Flash point | 149.988°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Thiophene-2-Carbothioic Acid S-Phenyl Ester |