|
CAS#: 28136-94-9 Product: 2-Chlorosantonin No suppilers available for the product. |
| Name | 2-Chlorosantonin |
|---|---|
| Synonyms | 7-Chloro-3,5A,9-Trimethyl-3A,4,5,9B-Tetrahydro-3H-Benzo[G]Benzofuran-2,8-Dione; 7-Chloro-3,5A,9-Trimethyl-3A,4,5,9B-Tetrahydro-3H-Benzo[G]Benzofuran-2,8-Quinone; .Alpha.-Chlorosantonin |
| Molecular Structure | ![]() |
| Molecular Formula | C15H17ClO3 |
| Molecular Weight | 280.75 |
| CAS Registry Number | 28136-94-9 |
| SMILES | CC3=C2C1OC(=O)C(C1CCC2(C)C=C(Cl)C3=O)C |
| InChI | 1S/C15H17ClO3/c1-7-9-4-5-15(3)6-10(16)12(17)8(2)11(15)13(9)19-14(7)18/h6-7,9,13H,4-5H2,1-3H3 |
| InChIKey | UXASVZPBDIQODI-UHFFFAOYSA-N |
| Density | 1.277g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.605°C at 760 mmHg (Cal.) |
| Flash point | 190.567°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chlorosantonin |