|
CAS#: 28165-73-3 Product: 2,6-Diiodo-Phenol Acetate No suppilers available for the product. |
| Name | 2,6-Diiodo-Phenol Acetate |
|---|---|
| Synonyms | Acetic Acid (2,6-Diiodophenyl) Ester; (2,6-Diiodophenyl) Ethanoate; Phenol,2,6-Diiodo-,Acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6I2O2 |
| Molecular Weight | 387.94 |
| CAS Registry Number | 28165-73-3 |
| SMILES | C1=C(C(=C(C=C1)I)OC(C)=O)I |
| InChI | 1S/C8H6I2O2/c1-5(11)12-8-6(9)3-2-4-7(8)10/h2-4H,1H3 |
| InChIKey | JCSYMLVRRUYACV-UHFFFAOYSA-N |
| Density | 2.266g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.558°C at 760 mmHg (Cal.) |
| Flash point | 167.626°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Diiodo-Phenol Acetate |