Online Database of Chemicals from Around the World
|
CAS#: 28177-14-2 Product: 5-(3-(2-Chloroethyl)Triazen-1-Yl)Imidazole-4-Carboxamide No suppilers available for the product. |
| Name | 5-(3-(2-Chloroethyl)Triazen-1-Yl)Imidazole-4-Carboxamide |
|---|---|
| Synonyms | (5Z)-5-[(2-Chloroethylamino)Hydrazinylidene]Imidazole-4-Carboxamide; 5-[(2-Chloroethylamino)Hydrazono]Imidazole-4-Carboxamide; (5Z)-5-[(2-Chloroethylamino)Hydrazono]Imidazole-4-Carboxamide |
| Molecular Structure |  |
| Molecular Formula | C6H9ClN6O |
| Molecular Weight | 216.63 |
| CAS Registry Number | 28177-14-2 |
| SMILES | C(NN\N=C\1N=CN=C1C(=O)N)CCl |
| InChI | 1S/C6H9ClN6O/c7-1-2-11-13-12-6-4(5(8)14)9-3-10-6/h3,11,13H,1-2H2,(H2,8,14)/b12-6- |
| InChIKey | LQBPAIKZGLEFMB-SDQBBNPISA-N |
| Density | 1.697g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.806°C at 760 mmHg (Cal.) |
| Flash point | 175.033°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(3-(2-Chloroethyl)Triazen-1-Yl)Imidazole-4-Carboxamide |