|
CAS#: 28191-75-5 Product: ({[1-(4-Chlorophenyl)Ethylidene]Amino}Oxy)Acetic Acid No suppilers available for the product. |
| Name | ({[1-(4-Chlorophenyl)Ethylidene]Amino}Oxy)Acetic Acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H10ClNO3 |
| Molecular Weight | 227.64 |
| CAS Registry Number | 28191-75-5 |
| SMILES | CC(=NOCC(=O)O)C1=CC=C(C=C1)Cl |
| InChI | 1S/C10H10ClNO3/c1-7(12-15-6-10(13)14)8-2-4-9(11)5-3-8/h2-5H,6H2,1H3,(H,13,14) |
| InChIKey | VPZKWIDEBRBPHA-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.3±52.0°C at 760 mmHg (Cal.) |
| Flash point | 172.3±30.7°C (Cal.) |
| Refractive index | 1.544 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for ({[1-(4-Chlorophenyl)Ethylidene]Amino}Oxy)Acetic Acid |