|
CAS#: 28239-49-8 Product: 5-Allyl-1,3-Dimethyl-5-(2-Pentanyl)-2,4,6(1H,3H,5H)-Pyrimidinetrione No suppilers available for the product. |
| Name | 5-Allyl-1,3-Dimethyl-5-(2-Pentanyl)-2,4,6(1H,3H,5H)-Pyrimidinetrione |
|---|---|
| Synonyms | 1,3-Dimethylsecobarbital; 5-Allyl-1 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 |
| CAS Registry Number | 28239-49-8 |
| SMILES | O=C1N(C(=O)C(C(=O)N1C)(C\C=C)C(C)CCC)C |
| InChI | 1S/C14H22N2O3/c1-6-8-10(3)14(9-7-2)11(17)15(4)13(19)16(5)12(14)18/h7,10H,2,6,8-9H2,1,3-5H3 |
| InChIKey | KKPCLTFASPTTIQ-UHFFFAOYSA-N |
| Density | 1.062g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.704°C at 760 mmHg (Cal.) |
| Flash point | 122.808°C (Cal.) |
| Refractive index | 1.487 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Allyl-1,3-Dimethyl-5-(2-Pentanyl)-2,4,6(1H,3H,5H)-Pyrimidinetrione |